About (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene
(4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene (PubChem CID 135196930) has the molecular formula C13H14S
and a molecular weight of 202.32 g/mol. Its IUPAC name is (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene.
Molecular Properties
| Compound Name | (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene |
| PubChem CID | 135196930 |
| Molecular Formula | C13H14S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene |
| SMILES | CCC1=CC=C(Sc2ccccc2)C1 |
| InChI | InChI=1S/C13H14S/c1-2-11-8-9-13(10-11)14-12-6-4-3-5-7-12/h3-9H,2,10H2,1H3 |
| InChIKey | DTVQPIHMMVVMQE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene?
The IUPAC name of (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene (CID 135196930) is (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene.
What is the SMILES notation for (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene?
The canonical SMILES for (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene is CCC1=CC=C(Sc2ccccc2)C1.
What is the InChIKey of (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene?
The InChIKey is DTVQPIHMMVVMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14S/c1-2-11-8-9-13(10-11)14-12-6-4-3-5-7-12/h3-9H,2,10H2,1H3.
What are the key properties of (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene?
(4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene has a molecular weight of 202.32 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylcyclopenta-1,3-dien-1-yl)sulfanylbenzene is sourced from PubChem (CID 135196930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).