About (4Z,6E)-7-bromohepta-4,6-dien-2-amine
(4Z,6E)-7-bromohepta-4,6-dien-2-amine (PubChem CID 135199063) has the molecular formula C7H12BrN
and a molecular weight of 190.08 g/mol. Its IUPAC name is (4Z,6E)-7-bromohepta-4,6-dien-2-amine.
Molecular Properties
| Compound Name | (4Z,6E)-7-bromohepta-4,6-dien-2-amine |
| PubChem CID | 135199063 |
| Molecular Formula | C7H12BrN |
| Molecular Weight | 190.08 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | (4Z,6E)-7-bromohepta-4,6-dien-2-amine |
| SMILES | CC(N)C/C=C\C=C\Br |
| InChI | InChI=1S/C7H12BrN/c1-7(9)5-3-2-4-6-8/h2-4,6-7H,5,9H2,1H3/b3-2-,6-4+ |
| InChIKey | TWSZXVFNCZZHPP-MGLVMYNNSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.08 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6E)-7-bromohepta-4,6-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6E)-7-bromohepta-4,6-dien-2-amine?
The IUPAC name of (4Z,6E)-7-bromohepta-4,6-dien-2-amine (CID 135199063) is (4Z,6E)-7-bromohepta-4,6-dien-2-amine.
What is the SMILES notation for (4Z,6E)-7-bromohepta-4,6-dien-2-amine?
The canonical SMILES for (4Z,6E)-7-bromohepta-4,6-dien-2-amine is CC(N)C/C=C\C=C\Br.
What is the InChIKey of (4Z,6E)-7-bromohepta-4,6-dien-2-amine?
The InChIKey is TWSZXVFNCZZHPP-MGLVMYNNSA-N. The full InChI is InChI=1S/C7H12BrN/c1-7(9)5-3-2-4-6-8/h2-4,6-7H,5,9H2,1H3/b3-2-,6-4+.
What are the key properties of (4Z,6E)-7-bromohepta-4,6-dien-2-amine?
(4Z,6E)-7-bromohepta-4,6-dien-2-amine has a molecular weight of 190.08 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6E)-7-bromohepta-4,6-dien-2-amine is sourced from PubChem (CID 135199063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).