C33H50N2 — CID 135199670
N-(4-tert-butylcyclohexyl)-4-[[4-[(4-tert-butylcyclohexyl)amino]phenyl]methyl]aniline (PubChem CID 135199670) has the molecular formula C33H50N2 and a molecular weight of 474.78 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-4-[[4-[(4-tert-butylcyclohexyl)amino]phenyl]methyl]aniline.
| Compound Name | N-(4-tert-butylcyclohexyl)-4-[[4-[(4-tert-butylcyclohexyl)amino]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 135199670 |
| Molecular Formula | C33H50N2 |
| Molecular Weight | 474.78 g/mol |
| Exact Mass | 474.40 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-4-[[4-[(4-tert-butylcyclohexyl)amino]phenyl]methyl]aniline |
| SMILES | CC(C)(C)C1CCC(Nc2ccc(Cc3ccc(NC4CCC(C(C)(C)C)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C33H50N2/c1-32(2,3)26-11-19-30(20-12-26)34-28-15-7-24(8-16-28)23-25-9-17-29(18-10-25)35-31-21-13-27(14-22-31)33(4,5)6/h7-10,15-18,26-27,30-31,34-35H,11-14,19-23H2,1-6H3 |
| InChIKey | HPRFYZJGECLHMQ-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.78 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|