C24H18N2O2S — CID 135199989
N-isoquinolin-6-yl-2-[4-(thiophene-2-carbonyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 135199989) has the molecular formula C24H18N2O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-isoquinolin-6-yl-2-[4-(thiophene-2-carbonyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-isoquinolin-6-yl-2-[4-(thiophene-2-carbonyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135199989 |
| Molecular Formula | C24H18N2O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-isoquinolin-6-yl-2-[4-(thiophene-2-carbonyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(c1ccc(C2CC2C(=O)Nc2ccc3cnccc3c2)cc1)c1cccs1 |
| InChI | InChI=1S/C24H18N2O2S/c27-23(22-2-1-11-29-22)16-5-3-15(4-6-16)20-13-21(20)24(28)26-19-8-7-18-14-25-10-9-17(18)12-19/h1-12,14,20-21H,13H2,(H,26,28) |
| InChIKey | GEZACHKSJNGICC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |