C14H25N — CID 135200521
N-[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]-3,3-dimethylbutan-2-imine (PubChem CID 135200521) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]-3,3-dimethylbutan-2-imine.
| Compound Name | N-[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]-3,3-dimethylbutan-2-imine |
|---|---|
| PubChem CID | 135200521 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]-3,3-dimethylbutan-2-imine |
| SMILES | C=C/C=C(\N=C(/C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H25N/c1-9-10-12(14(6,7)8)15-11(2)13(3,4)5/h9-10H,1H2,2-8H3/b12-10-,15-11+ |
| InChIKey | SNNPWCRHYDQTMY-MOPKJALQSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|