About 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline
5-(2-methylpropyl)-4a,8a-dihydroisoquinoline (PubChem CID 135200694) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline.
Molecular Properties
| Compound Name | 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline |
| PubChem CID | 135200694 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline |
| SMILES | CC(C)CC1=CC=CC2C=NC=CC12 |
| InChI | InChI=1S/C13H17N/c1-10(2)8-11-4-3-5-12-9-14-7-6-13(11)12/h3-7,9-10,12-13H,8H2,1-2H3 |
| InChIKey | OZMNQOOGNWFPRK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline?
The IUPAC name of 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline (CID 135200694) is 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline.
What is the SMILES notation for 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline?
The canonical SMILES for 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline is CC(C)CC1=CC=CC2C=NC=CC12.
What is the InChIKey of 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline?
The InChIKey is OZMNQOOGNWFPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-10(2)8-11-4-3-5-12-9-14-7-6-13(11)12/h3-7,9-10,12-13H,8H2,1-2H3.
What are the key properties of 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline?
5-(2-methylpropyl)-4a,8a-dihydroisoquinoline has a molecular weight of 187.29 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylpropyl)-4a,8a-dihydroisoquinoline is sourced from PubChem (CID 135200694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).