C16H24O4 — CID 135200904
2-O-[(2R)-3,3-dimethylbutan-2-yl] 1-O-[(3-methylcyclohexa-1,5-dien-1-yl)methyl] oxalate (PubChem CID 135200904) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-O-[(2R)-3,3-dimethylbutan-2-yl] 1-O-[(3-methylcyclohexa-1,5-dien-1-yl)methyl] oxalate.
| Compound Name | 2-O-[(2R)-3,3-dimethylbutan-2-yl] 1-O-[(3-methylcyclohexa-1,5-dien-1-yl)methyl] oxalate |
|---|---|
| PubChem CID | 135200904 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-O-[(2R)-3,3-dimethylbutan-2-yl] 1-O-[(3-methylcyclohexa-1,5-dien-1-yl)methyl] oxalate |
| SMILES | CC1C=C(COC(=O)C(=O)O[C@H](C)C(C)(C)C)C=CC1 |
| InChI | InChI=1S/C16H24O4/c1-11-7-6-8-13(9-11)10-19-14(17)15(18)20-12(2)16(3,4)5/h6,8-9,11-12H,7,10H2,1-5H3/t11?,12-/m1/s1 |
| InChIKey | SJNKIINTBNGPOV-PIJUOVFKSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|