About (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride
(E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride (PubChem CID 135200909) has the molecular formula C5H5ClF3N
and a molecular weight of 171.55 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride.
Molecular Properties
| Compound Name | (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride |
| PubChem CID | 135200909 |
| Molecular Formula | C5H5ClF3N |
| Molecular Weight | 171.55 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride |
| SMILES | [H]/N=C(Cl)/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C5H5ClF3N/c1-3(2-4(6)10)5(7,8)9/h2,10H,1H3/b3-2+,10-4- |
| InChIKey | UPBIKDBRUYXVPZ-VAIMCSMNSA-N |
| XLogP | 2.71 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride?
The IUPAC name of (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride (CID 135200909) is (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride.
What is the SMILES notation for (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride?
The canonical SMILES for (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride is [H]/N=C(Cl)/C=C(\C)C(F)(F)F.
What is the InChIKey of (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride?
The InChIKey is UPBIKDBRUYXVPZ-VAIMCSMNSA-N. The full InChI is InChI=1S/C5H5ClF3N/c1-3(2-4(6)10)5(7,8)9/h2,10H,1H3/b3-2+,10-4-.
What are the key properties of (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride?
(E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride has a molecular weight of 171.55 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4,4-trifluoro-3-methylbut-2-enimidoyl chloride is sourced from PubChem (CID 135200909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).