About 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide
6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide (PubChem CID 135201111) has the molecular formula C14H8F4N2O2S
and a molecular weight of 344.29 g/mol. Its IUPAC name is 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide.
Molecular Properties
| Compound Name | 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide |
| PubChem CID | 135201111 |
| Molecular Formula | C14H8F4N2O2S |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(F)cc1F)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C14H8F4N2O2S/c15-7-1-2-8-12(3-7)19-6-14(8)23(21,22)20-13-5-10(17)9(16)4-11(13)18/h1-6,19-20H |
| InChIKey | NSEOKOTXONIGAA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide?
The IUPAC name of 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide (CID 135201111) is 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide.
What is the SMILES notation for 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide?
The canonical SMILES for 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide is O=S(=O)(Nc1cc(F)c(F)cc1F)c1c[nH]c2cc(F)ccc12.
What is the InChIKey of 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide?
The InChIKey is NSEOKOTXONIGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F4N2O2S/c15-7-1-2-8-12(3-7)19-6-14(8)23(21,22)20-13-5-10(17)9(16)4-11(13)18/h1-6,19-20H.
What are the key properties of 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide?
6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide has a molecular weight of 344.29 g/mol, XLogP of 3.53, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N-(2,4,5-trifluorophenyl)-1H-indole-3-sulfonamide is sourced from PubChem (CID 135201111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).