C8H8F2N2O3 — CID 135201369
ethyl 3-(difluoromethyl)-6-oxo-1H-pyridazine-5-carboxylate (PubChem CID 135201369) has the molecular formula C8H8F2N2O3 and a molecular weight of 218.16 g/mol. Its IUPAC name is ethyl 3-(difluoromethyl)-6-oxo-1H-pyridazine-5-carboxylate.
| Compound Name | ethyl 3-(difluoromethyl)-6-oxo-1H-pyridazine-5-carboxylate |
|---|---|
| PubChem CID | 135201369 |
| Molecular Formula | C8H8F2N2O3 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | ethyl 3-(difluoromethyl)-6-oxo-1H-pyridazine-5-carboxylate |
| SMILES | CCOC(=O)c1cc(C(F)F)n[nH]c1=O |
| InChI | InChI=1S/C8H8F2N2O3/c1-2-15-8(14)4-3-5(6(9)10)11-12-7(4)13/h3,6H,2H2,1H3,(H,12,13) |
| InChIKey | LZRZWVLXBSVOIW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |