About 5-fluoro-2,1,3-benzothiadiazol-4-amine
5-fluoro-2,1,3-benzothiadiazol-4-amine (PubChem CID 135201514) has the molecular formula C6H4FN3S
and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-fluoro-2,1,3-benzothiadiazol-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-2,1,3-benzothiadiazol-4-amine |
| PubChem CID | 135201514 |
| Molecular Formula | C6H4FN3S |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.01 |
| IUPAC Name | 5-fluoro-2,1,3-benzothiadiazol-4-amine |
| SMILES | Nc1c(F)ccc2nsnc12 |
| InChI | InChI=1S/C6H4FN3S/c7-3-1-2-4-6(5(3)8)10-11-9-4/h1-2H,8H2 |
| InChIKey | WJIVVYMEPHKJIQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2,1,3-benzothiadiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,1,3-benzothiadiazol-4-amine?
The IUPAC name of 5-fluoro-2,1,3-benzothiadiazol-4-amine (CID 135201514) is 5-fluoro-2,1,3-benzothiadiazol-4-amine.
What is the SMILES notation for 5-fluoro-2,1,3-benzothiadiazol-4-amine?
The canonical SMILES for 5-fluoro-2,1,3-benzothiadiazol-4-amine is Nc1c(F)ccc2nsnc12.
What is the InChIKey of 5-fluoro-2,1,3-benzothiadiazol-4-amine?
The InChIKey is WJIVVYMEPHKJIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FN3S/c7-3-1-2-4-6(5(3)8)10-11-9-4/h1-2H,8H2.
What are the key properties of 5-fluoro-2,1,3-benzothiadiazol-4-amine?
5-fluoro-2,1,3-benzothiadiazol-4-amine has a molecular weight of 169.18 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,1,3-benzothiadiazol-4-amine is sourced from PubChem (CID 135201514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).