C16H19N — CID 135201650
13,13-dimethyl-2-azatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene (PubChem CID 135201650) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 13,13-dimethyl-2-azatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene.
| Compound Name | 13,13-dimethyl-2-azatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
|---|---|
| PubChem CID | 135201650 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 13,13-dimethyl-2-azatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
| SMILES | CC1(C)CCCc2cccc3ccnc(c23)C1 |
| InChI | InChI=1S/C16H19N/c1-16(2)9-4-7-12-5-3-6-13-8-10-17-14(11-16)15(12)13/h3,5-6,8,10H,4,7,9,11H2,1-2H3 |
| InChIKey | DZIACWBLCFSNJD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |