About 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine
5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine (PubChem CID 135201820) has the molecular formula C11H6ClF2N5
and a molecular weight of 281.65 g/mol. Its IUPAC name is 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 135201820 |
| Molecular Formula | C11H6ClF2N5 |
| Molecular Weight | 281.65 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine |
| SMILES | FC(F)c1cc(-c2nc3nc(Cl)ccc3[nH]2)cnn1 |
| InChI | InChI=1S/C11H6ClF2N5/c12-8-2-1-6-11(17-8)18-10(16-6)5-3-7(9(13)14)19-15-4-5/h1-4,9H,(H,16,17,18) |
| InChIKey | LHFMMNUTLYUVBU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine (CID 135201820) is 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine is FC(F)c1cc(-c2nc3nc(Cl)ccc3[nH]2)cnn1.
What is the InChIKey of 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine?
The InChIKey is LHFMMNUTLYUVBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClF2N5/c12-8-2-1-6-11(17-8)18-10(16-6)5-3-7(9(13)14)19-15-4-5/h1-4,9H,(H,16,17,18).
What are the key properties of 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine?
5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine has a molecular weight of 281.65 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[6-(difluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 135201820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).