C30H36N2O4 — CID 135201950
N,N-dibutyl-2-(3-hydroxy-6-propan-2-yl-3,4-dihydroquinolin-2-yl)-1,3-dioxoindene-5-carboxamide (PubChem CID 135201950) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is N,N-dibutyl-2-(3-hydroxy-6-propan-2-yl-3,4-dihydroquinolin-2-yl)-1,3-dioxoindene-5-carboxamide.
| Compound Name | N,N-dibutyl-2-(3-hydroxy-6-propan-2-yl-3,4-dihydroquinolin-2-yl)-1,3-dioxoindene-5-carboxamide |
|---|---|
| PubChem CID | 135201950 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | N,N-dibutyl-2-(3-hydroxy-6-propan-2-yl-3,4-dihydroquinolin-2-yl)-1,3-dioxoindene-5-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc2c(c1)C(=O)C(C1=Nc3ccc(C(C)C)cc3CC1O)C2=O |
| InChI | InChI=1S/C30H36N2O4/c1-5-7-13-32(14-8-6-2)30(36)20-9-11-22-23(16-20)29(35)26(28(22)34)27-25(33)17-21-15-19(18(3)4)10-12-24(21)31-27/h9-12,15-16,18,25-26,33H,5-8,13-14,17H2,1-4H3 |
| InChIKey | WEJRABRCWMZFJZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|