C10H16S — CID 135202053
(4S,5S)-2,4,5-trimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophene (PubChem CID 135202053) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is (4S,5S)-2,4,5-trimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophene.
| Compound Name | (4S,5S)-2,4,5-trimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 135202053 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (4S,5S)-2,4,5-trimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophene |
| SMILES | CC1=CC2C(C[C@H](C)[C@@H]2C)S1 |
| InChI | InChI=1S/C10H16S/c1-6-4-10-9(8(6)3)5-7(2)11-10/h5-6,8-10H,4H2,1-3H3/t6-,8-,9?,10?/m0/s1 |
| InChIKey | BRYOPQWEPWQXJA-FXQVNJNESA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |