About (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one
(4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one (PubChem CID 135202415) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one |
| PubChem CID | 135202415 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one |
| SMILES | C/C=C(C)\C=c1\[nH]c(=O)o\c1=C\C |
| InChI | InChI=1S/C10H13NO2/c1-4-7(3)6-8-9(5-2)13-10(12)11-8/h4-6H,1-3H3,(H,11,12)/b7-4-,8-6+,9-5+ |
| InChIKey | GECZIIPLJLDULT-RSOCWDBNSA-N |
| XLogP | 0.51 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one?
The IUPAC name of (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one (CID 135202415) is (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one.
What is the SMILES notation for (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one?
The canonical SMILES for (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one is C/C=C(C)\C=c1\[nH]c(=O)o\c1=C\C.
What is the InChIKey of (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one?
The InChIKey is GECZIIPLJLDULT-RSOCWDBNSA-N. The full InChI is InChI=1S/C10H13NO2/c1-4-7(3)6-8-9(5-2)13-10(12)11-8/h4-6H,1-3H3,(H,11,12)/b7-4-,8-6+,9-5+.
What are the key properties of (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one?
(4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one has a molecular weight of 179.22 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-5-ethylidene-4-[(Z)-2-methylbut-2-enylidene]-1,3-oxazolidin-2-one is sourced from PubChem (CID 135202415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).