C11H15N3O — CID 135202509
2-[(8aR)-1,5,6,8a-tetrahydroimidazo[1,2-a]pyridin-3-yl]-N-methylprop-2-enamide (PubChem CID 135202509) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[(8aR)-1,5,6,8a-tetrahydroimidazo[1,2-a]pyridin-3-yl]-N-methylprop-2-enamide.
| Compound Name | 2-[(8aR)-1,5,6,8a-tetrahydroimidazo[1,2-a]pyridin-3-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 135202509 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2-[(8aR)-1,5,6,8a-tetrahydroimidazo[1,2-a]pyridin-3-yl]-N-methylprop-2-enamide |
| SMILES | C=C(C(=O)NC)C1=CN[C@H]2C=CCCN12 |
| InChI | InChI=1S/C11H15N3O/c1-8(11(15)12-2)9-7-13-10-5-3-4-6-14(9)10/h3,5,7,10,13H,1,4,6H2,2H3,(H,12,15)/t10-/m1/s1 |
| InChIKey | XPJLVJRXJGLZEN-SNVBAGLBSA-N |
| XLogP | 0.32 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|