About 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine
1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine (PubChem CID 135202533) has the molecular formula C8H15FN2
and a molecular weight of 158.22 g/mol. Its IUPAC name is 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine |
| PubChem CID | 135202533 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine |
| SMILES | C=C(/C(F)=C\CC)N(C)NC |
| InChI | InChI=1S/C8H15FN2/c1-5-6-8(9)7(2)11(4)10-3/h6,10H,2,5H2,1,3-4H3/b8-6+ |
| InChIKey | DIWRABUZAXNASC-SOFGYWHQSA-N |
| XLogP | 1.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine?
The IUPAC name of 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine (CID 135202533) is 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine.
What is the SMILES notation for 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine?
The canonical SMILES for 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine is C=C(/C(F)=C\CC)N(C)NC.
What is the InChIKey of 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine?
The InChIKey is DIWRABUZAXNASC-SOFGYWHQSA-N. The full InChI is InChI=1S/C8H15FN2/c1-5-6-8(9)7(2)11(4)10-3/h6,10H,2,5H2,1,3-4H3/b8-6+.
What are the key properties of 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine?
1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine has a molecular weight of 158.22 g/mol, XLogP of 1.83, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-3-fluorohexa-1,3-dien-2-yl]-1,2-dimethylhydrazine is sourced from PubChem (CID 135202533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).