About (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol
(2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol (PubChem CID 135202827) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol.
Molecular Properties
| Compound Name | (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol |
| PubChem CID | 135202827 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol |
| SMILES | CCc1cncc(OC[C@H](O)CO)n1 |
| InChI | InChI=1S/C9H14N2O3/c1-2-7-3-10-4-9(11-7)14-6-8(13)5-12/h3-4,8,12-13H,2,5-6H2,1H3/t8-/m1/s1 |
| InChIKey | ICTPZHXSHGWIDR-MRVPVSSYSA-N |
| XLogP | -0.23 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol?
The IUPAC name of (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol (CID 135202827) is (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol.
What is the SMILES notation for (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol?
The canonical SMILES for (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol is CCc1cncc(OC[C@H](O)CO)n1.
What is the InChIKey of (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol?
The InChIKey is ICTPZHXSHGWIDR-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-2-7-3-10-4-9(11-7)14-6-8(13)5-12/h3-4,8,12-13H,2,5-6H2,1H3/t8-/m1/s1.
What are the key properties of (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol?
(2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol has a molecular weight of 198.22 g/mol, XLogP of -0.23, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(6-ethylpyrazin-2-yl)oxypropane-1,2-diol is sourced from PubChem (CID 135202827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).