C8H14N2O4S — CID 135204657
(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl methanesulfonate (PubChem CID 135204657) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is (5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl methanesulfonate.
| Compound Name | (5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 135204657 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl methanesulfonate |
| SMILES | CC(C)(C)c1nc(COS(C)(=O)=O)no1 |
| InChI | InChI=1S/C8H14N2O4S/c1-8(2,3)7-9-6(10-14-7)5-13-15(4,11)12/h5H2,1-4H3 |
| InChIKey | MSPSWZNZHSRIJJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|