C18H15F4N5O — CID 135204674
(2S,4S)-4-fluoro-2-[4-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-2,3-dihydroindole-1-carbonyl]pyrrolidine-1-carbonitrile (PubChem CID 135204674) has the molecular formula C18H15F4N5O and a molecular weight of 393.34 g/mol. Its IUPAC name is (2S,4S)-4-fluoro-2-[4-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-2,3-dihydroindole-1-carbonyl]pyrrolidine-1-carbonitrile.
| Compound Name | (2S,4S)-4-fluoro-2-[4-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-2,3-dihydroindole-1-carbonyl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 135204674 |
| Molecular Formula | C18H15F4N5O |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (2S,4S)-4-fluoro-2-[4-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-2,3-dihydroindole-1-carbonyl]pyrrolidine-1-carbonitrile |
| SMILES | N#CN1C[C@@H](F)C[C@H]1C(=O)N1CCc2c(-c3cn[nH]c3C(F)(F)F)cccc21 |
| InChI | InChI=1S/C18H15F4N5O/c19-10-6-15(26(8-10)9-23)17(28)27-5-4-12-11(2-1-3-14(12)27)13-7-24-25-16(13)18(20,21)22/h1-3,7,10,15H,4-6,8H2,(H,24,25)/t10-,15-/m0/s1 |
| InChIKey | AHCBJXSHVXHGHF-BONVTDFDSA-N |
| XLogP | 2.88 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|