C18H17F2N5O — CID 135205376
(2S)-4,4-difluoro-2-[4-(5-methyl-1H-pyrazol-4-yl)-2,3-dihydroindole-1-carbonyl]pyrrolidine-1-carbonitrile (PubChem CID 135205376) has the molecular formula C18H17F2N5O and a molecular weight of 357.36 g/mol. Its IUPAC name is (2S)-4,4-difluoro-2-[4-(5-methyl-1H-pyrazol-4-yl)-2,3-dihydroindole-1-carbonyl]pyrrolidine-1-carbonitrile.
| Compound Name | (2S)-4,4-difluoro-2-[4-(5-methyl-1H-pyrazol-4-yl)-2,3-dihydroindole-1-carbonyl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 135205376 |
| Molecular Formula | C18H17F2N5O |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2S)-4,4-difluoro-2-[4-(5-methyl-1H-pyrazol-4-yl)-2,3-dihydroindole-1-carbonyl]pyrrolidine-1-carbonitrile |
| SMILES | Cc1[nH]ncc1-c1cccc2c1CCN2C(=O)[C@@H]1CC(F)(F)CN1C#N |
| InChI | InChI=1S/C18H17F2N5O/c1-11-14(8-22-23-11)12-3-2-4-15-13(12)5-6-25(15)17(26)16-7-18(19,20)9-24(16)10-21/h2-4,8,16H,5-7,9H2,1H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | XOANBZMRYZSVBZ-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|