C28H28F3N5O4S — CID 135205596
N-[1-[4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]phenyl]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 135205596) has the molecular formula C28H28F3N5O4S and a molecular weight of 587.62 g/mol. Its IUPAC name is N-[1-[4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]phenyl]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]phenyl]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 135205596 |
| Molecular Formula | C28H28F3N5O4S |
| Molecular Weight | 587.62 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | N-[1-[4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridin-4-yl]phenyl]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(Cn2nc(N3CCS(=O)(=O)CC3)c3c(-c4ccc(C(C)NC(=O)C(F)(F)F)cc4)ccnc32)cc1 |
| InChI | InChI=1S/C28H28F3N5O4S/c1-18(33-27(37)28(29,30)31)20-5-7-21(8-6-20)23-11-12-32-25-24(23)26(35-13-15-41(38,39)16-14-35)34-36(25)17-19-3-9-22(40-2)10-4-19/h3-12,18H,13-17H2,1-2H3,(H,33,37) |
| InChIKey | WZUMGVBURZLJBR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |