C8H12N2O — CID 135207849
(2E,4Z)-N,2-dimethyl-5-(methylideneamino)penta-2,4-dienamide (PubChem CID 135207849) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is (2E,4Z)-N,2-dimethyl-5-(methylideneamino)penta-2,4-dienamide.
| Compound Name | (2E,4Z)-N,2-dimethyl-5-(methylideneamino)penta-2,4-dienamide |
|---|---|
| PubChem CID | 135207849 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (2E,4Z)-N,2-dimethyl-5-(methylideneamino)penta-2,4-dienamide |
| SMILES | C=N/C=C\C=C(/C)C(=O)NC |
| InChI | InChI=1S/C8H12N2O/c1-7(8(11)10-3)5-4-6-9-2/h4-6H,2H2,1,3H3,(H,10,11)/b6-4-,7-5+ |
| InChIKey | IDPSRSFYICUEQA-XGXWUAJZSA-N |
| XLogP | 0.89 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|