C12H25N3 — CID 135207982
(2E,4E)-2-N-[2-(dimethylamino)ethyl]-2-N-methylhepta-2,4-diene-2,5-diamine (PubChem CID 135207982) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is (2E,4E)-2-N-[2-(dimethylamino)ethyl]-2-N-methylhepta-2,4-diene-2,5-diamine.
| Compound Name | (2E,4E)-2-N-[2-(dimethylamino)ethyl]-2-N-methylhepta-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 135207982 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | (2E,4E)-2-N-[2-(dimethylamino)ethyl]-2-N-methylhepta-2,4-diene-2,5-diamine |
| SMILES | CC/C(=C\C=C(/C)\N(C)CCN(C)C)/N |
| InChI | InChI=1S/C12H25N3/c1-6-12(13)8-7-11(2)15(5)10-9-14(3)4/h7-8H,6,9-10,13H2,1-5H3/b11-7+,12-8+ |
| InChIKey | RRXCIFDDIIZNLC-MKICQXMISA-N |
| XLogP | 1.80 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | 229 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|