About 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene
1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene (PubChem CID 135208021) has the molecular formula C26H23F
and a molecular weight of 354.47 g/mol. Its IUPAC name is 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene.
Molecular Properties
| Compound Name | 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene |
| PubChem CID | 135208021 |
| Molecular Formula | C26H23F |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene |
| SMILES | C=C1c2cccc(F)c2C(C)(C)c2cccc(/C(=C\C)c3ccccc3)c21 |
| InChI | InChI=1S/C26H23F/c1-5-19(18-11-7-6-8-12-18)21-14-9-15-22-24(21)17(2)20-13-10-16-23(27)25(20)26(22,3)4/h5-16H,2H2,1,3-4H3/b19-5- |
| InChIKey | SSVTUXOSUMISQG-IPKBDRFQSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene?
The IUPAC name of 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene (CID 135208021) is 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene.
What is the SMILES notation for 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene?
The canonical SMILES for 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene is C=C1c2cccc(F)c2C(C)(C)c2cccc(/C(=C\C)c3ccccc3)c21.
What is the InChIKey of 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene?
The InChIKey is SSVTUXOSUMISQG-IPKBDRFQSA-N. The full InChI is InChI=1S/C26H23F/c1-5-19(18-11-7-6-8-12-18)21-14-9-15-22-24(21)17(2)20-13-10-16-23(27)25(20)26(22,3)4/h5-16H,2H2,1,3-4H3/b19-5-.
What are the key properties of 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene?
1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene has a molecular weight of 354.47 g/mol, XLogP of 6.98, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-9,9-dimethyl-10-methylidene-5-[(Z)-1-phenylprop-1-enyl]anthracene is sourced from PubChem (CID 135208021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).