C8H16N4 — CID 135208513
(1E)-1-N-[(ethenylamino)methyl]-1-N-methylbuta-1,3-diene-1,2,3-triamine (PubChem CID 135208513) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is (1E)-1-N-[(ethenylamino)methyl]-1-N-methylbuta-1,3-diene-1,2,3-triamine.
| Compound Name | (1E)-1-N-[(ethenylamino)methyl]-1-N-methylbuta-1,3-diene-1,2,3-triamine |
|---|---|
| PubChem CID | 135208513 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | (1E)-1-N-[(ethenylamino)methyl]-1-N-methylbuta-1,3-diene-1,2,3-triamine |
| SMILES | C=CNCN(C)/C=C(/N)C(=C)N |
| InChI | InChI=1S/C8H16N4/c1-4-11-6-12(3)5-8(10)7(2)9/h4-5,11H,1-2,6,9-10H2,3H3/b8-5+ |
| InChIKey | YFRTVZLKDAPNQZ-VMPITWQZSA-N |
| XLogP | -0.12 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|