C37H40O2S3 — CID 135208847
14,14-bis(4-hexylphenyl)-3,7,10-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,11-tetraene-4,11-dicarbaldehyde (PubChem CID 135208847) has the molecular formula C37H40O2S3 and a molecular weight of 612.93 g/mol. Its IUPAC name is 14,14-bis(4-hexylphenyl)-3,7,10-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,11-tetraene-4,11-dicarbaldehyde.
| Compound Name | 14,14-bis(4-hexylphenyl)-3,7,10-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,11-tetraene-4,11-dicarbaldehyde |
|---|---|
| PubChem CID | 135208847 |
| Molecular Formula | C37H40O2S3 |
| Molecular Weight | 612.93 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | 14,14-bis(4-hexylphenyl)-3,7,10-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,11-tetraene-4,11-dicarbaldehyde |
| SMILES | CCCCCCc1ccc(C2(c3ccc(CCCCCC)cc3)c3c(sc4cc(C=O)sc34)C3SC(C=O)=CC32)cc1 |
| InChI | InChI=1S/C37H40O2S3/c1-3-5-7-9-11-25-13-17-27(18-14-25)37(28-19-15-26(16-20-28)12-10-8-6-4-2)31-21-29(23-38)40-34(31)36-33(37)35-32(42-36)22-30(24-39)41-35/h13-24,31,34H,3-12H2,1-2H3 |
| InChIKey | JIFGYNLAPNLVGO-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.93 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|