C18H19N5OS — CID 135209359
N-[1-[(3-methylphenyl)methyl]imidazol-4-yl]-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridine-2-carboxamide (PubChem CID 135209359) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is N-[1-[(3-methylphenyl)methyl]imidazol-4-yl]-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridine-2-carboxamide.
| Compound Name | N-[1-[(3-methylphenyl)methyl]imidazol-4-yl]-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135209359 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[1-[(3-methylphenyl)methyl]imidazol-4-yl]-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridine-2-carboxamide |
| SMILES | Cc1cccc(Cn2cnc(NC(=O)c3nc4c(s3)CCNC4)c2)c1 |
| InChI | InChI=1S/C18H19N5OS/c1-12-3-2-4-13(7-12)9-23-10-16(20-11-23)22-17(24)18-21-14-8-19-6-5-15(14)25-18/h2-4,7,10-11,19H,5-6,8-9H2,1H3,(H,22,24) |
| InChIKey | BDBWDRAWDGCDAP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |