C21H12F13NO3S — CID 135209695
[(E)-[1-(9H-fluoren-2-yl)-2,2,3,3,4,4,4-heptafluorobutylidene]amino] 1,1,2,2,3,3-hexafluorobutane-1-sulfonate (PubChem CID 135209695) has the molecular formula C21H12F13NO3S and a molecular weight of 605.37 g/mol. Its IUPAC name is [(E)-[1-(9H-fluoren-2-yl)-2,2,3,3,4,4,4-heptafluorobutylidene]amino] 1,1,2,2,3,3-hexafluorobutane-1-sulfonate.
| Compound Name | [(E)-[1-(9H-fluoren-2-yl)-2,2,3,3,4,4,4-heptafluorobutylidene]amino] 1,1,2,2,3,3-hexafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 135209695 |
| Molecular Formula | C21H12F13NO3S |
| Molecular Weight | 605.37 g/mol |
| Exact Mass | 605.03 |
| IUPAC Name | [(E)-[1-(9H-fluoren-2-yl)-2,2,3,3,4,4,4-heptafluorobutylidene]amino] 1,1,2,2,3,3-hexafluorobutane-1-sulfonate |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O/N=C(\c1ccc2c(c1)Cc1ccccc1-2)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H12F13NO3S/c1-16(22,23)18(26,27)21(33,34)39(36,37)38-35-15(17(24,25)19(28,29)20(30,31)32)11-6-7-14-12(9-11)8-10-4-2-3-5-13(10)14/h2-7,9H,8H2,1H3/b35-15+ |
| InChIKey | VEBAOABQTKZJMQ-PTEHHBOZSA-N |
| XLogP | 7.02 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.37 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|