C28H30FN9O3 — CID 135210111
(2R,3R)-3-[[4-[4-[[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]methyl]-3-fluorophenyl]-1H-pyrazolo[3,4-b]pyridin-3-yl]amino]-2-methylpiperidine-1-carbonyl cyanide (PubChem CID 135210111) has the molecular formula C28H30FN9O3 and a molecular weight of 559.61 g/mol. Its IUPAC name is (2R,3R)-3-[[4-[4-[[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]methyl]-3-fluorophenyl]-1H-pyrazolo[3,4-b]pyridin-3-yl]amino]-2-methylpiperidine-1-carbonyl cyanide.
| Compound Name | (2R,3R)-3-[[4-[4-[[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]methyl]-3-fluorophenyl]-1H-pyrazolo[3,4-b]pyridin-3-yl]amino]-2-methylpiperidine-1-carbonyl cyanide |
|---|---|
| PubChem CID | 135210111 |
| Molecular Formula | C28H30FN9O3 |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | (2R,3R)-3-[[4-[4-[[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]methyl]-3-fluorophenyl]-1H-pyrazolo[3,4-b]pyridin-3-yl]amino]-2-methylpiperidine-1-carbonyl cyanide |
| SMILES | C[C@@H]1[C@H](Nc2n[nH]c3nccc(-c4ccc(CNC(=O)c5noc(C(C)(C)C)n5)c(F)c4)c23)CCCN1C(=O)C#N |
| InChI | InChI=1S/C28H30FN9O3/c1-15-20(6-5-11-38(15)21(39)13-30)33-24-22-18(9-10-31-23(22)35-36-24)16-7-8-17(19(29)12-16)14-32-26(40)25-34-27(41-37-25)28(2,3)4/h7-10,12,15,20H,5-6,11,14H2,1-4H3,(H,32,40)(H2,31,33,35,36)/t15-,20-/m1/s1 |
| InChIKey | BBBYUWOVPDPCOS-FOIQADDNSA-N |
| XLogP | 3.69 |
| TPSA | 165.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|