C45H27Cl5 — CID 135210142
10-(9,9-dimethylfluoren-2-yl)-9-naphthalen-1-yl-2-(2,3,4,5,6-pentachlorophenyl)anthracene (PubChem CID 135210142) has the molecular formula C45H27Cl5 and a molecular weight of 744.98 g/mol. Its IUPAC name is 10-(9,9-dimethylfluoren-2-yl)-9-naphthalen-1-yl-2-(2,3,4,5,6-pentachlorophenyl)anthracene.
| Compound Name | 10-(9,9-dimethylfluoren-2-yl)-9-naphthalen-1-yl-2-(2,3,4,5,6-pentachlorophenyl)anthracene |
|---|---|
| PubChem CID | 135210142 |
| Molecular Formula | C45H27Cl5 |
| Molecular Weight | 744.98 g/mol |
| Exact Mass | 742.06 |
| IUPAC Name | 10-(9,9-dimethylfluoren-2-yl)-9-naphthalen-1-yl-2-(2,3,4,5,6-pentachlorophenyl)anthracene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3c4ccccc4c(-c4cccc5ccccc45)c4cc(-c5c(Cl)c(Cl)c(Cl)c(Cl)c5Cl)ccc34)cc21 |
| InChI | InChI=1S/C45H27Cl5/c1-45(2)35-17-8-7-13-28(35)29-20-18-26(23-36(29)45)37-31-14-5-6-15-32(31)39(30-16-9-11-24-10-3-4-12-27(24)30)34-22-25(19-21-33(34)37)38-40(46)42(48)44(50)43(49)41(38)47/h3-23H,1-2H3 |
| InChIKey | SNYWYTYKFPVFBV-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.98 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|