C48H46O6 — CID 135210507
3-[2-[4-[1-[4-[2-(oxiran-2-ylmethoxy)ethoxy]-3-phenylphenyl]-1-(4-phenylphenyl)ethyl]-2-phenylphenoxy]ethoxy]oxetane (PubChem CID 135210507) has the molecular formula C48H46O6 and a molecular weight of 718.89 g/mol. Its IUPAC name is 3-[2-[4-[1-[4-[2-(oxiran-2-ylmethoxy)ethoxy]-3-phenylphenyl]-1-(4-phenylphenyl)ethyl]-2-phenylphenoxy]ethoxy]oxetane.
| Compound Name | 3-[2-[4-[1-[4-[2-(oxiran-2-ylmethoxy)ethoxy]-3-phenylphenyl]-1-(4-phenylphenyl)ethyl]-2-phenylphenoxy]ethoxy]oxetane |
|---|---|
| PubChem CID | 135210507 |
| Molecular Formula | C48H46O6 |
| Molecular Weight | 718.89 g/mol |
| Exact Mass | 718.33 |
| IUPAC Name | 3-[2-[4-[1-[4-[2-(oxiran-2-ylmethoxy)ethoxy]-3-phenylphenyl]-1-(4-phenylphenyl)ethyl]-2-phenylphenoxy]ethoxy]oxetane |
| SMILES | CC(c1ccc(-c2ccccc2)cc1)(c1ccc(OCCOCC2CO2)c(-c2ccccc2)c1)c1ccc(OCCOC2COC2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C48H46O6/c1-48(39-19-17-36(18-20-39)35-11-5-2-6-12-35,40-21-23-46(52-26-25-49-31-43-34-54-43)44(29-40)37-13-7-3-8-14-37)41-22-24-47(53-28-27-51-42-32-50-33-42)45(30-41)38-15-9-4-10-16-38/h2-24,29-30,42-43H,25-28,31-34H2,1H3 |
| InChIKey | QSAYADYEKHZZFJ-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.89 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|