C28H44N2O — CID 135211119
(3E,5E)-1-[5-(1-aminoethenyl)cyclohept-3-en-1-yl]-6-(4,4-dimethylazepan-1-yl)-3-ethenyl-4-ethylhepta-3,5-dien-2-one (PubChem CID 135211119) has the molecular formula C28H44N2O and a molecular weight of 424.67 g/mol. Its IUPAC name is (3E,5E)-1-[5-(1-aminoethenyl)cyclohept-3-en-1-yl]-6-(4,4-dimethylazepan-1-yl)-3-ethenyl-4-ethylhepta-3,5-dien-2-one.
| Compound Name | (3E,5E)-1-[5-(1-aminoethenyl)cyclohept-3-en-1-yl]-6-(4,4-dimethylazepan-1-yl)-3-ethenyl-4-ethylhepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 135211119 |
| Molecular Formula | C28H44N2O |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.35 |
| IUPAC Name | (3E,5E)-1-[5-(1-aminoethenyl)cyclohept-3-en-1-yl]-6-(4,4-dimethylazepan-1-yl)-3-ethenyl-4-ethylhepta-3,5-dien-2-one |
| SMILES | C=C/C(C(=O)CC1CC=CC(C(=C)N)CC1)=C(\C=C(/C)N1CCCC(C)(C)CC1)CC |
| InChI | InChI=1S/C28H44N2O/c1-7-24(19-21(3)30-17-10-15-28(5,6)16-18-30)26(8-2)27(31)20-23-11-9-12-25(14-13-23)22(4)29/h8-9,12,19,23,25H,2,4,7,10-11,13-18,20,29H2,1,3,5-6H3/b21-19+,26-24+ |
| InChIKey | GDBMVXPECOSVSI-NGGVSRBESA-N |
| XLogP | 6.70 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|