About 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile
9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile (PubChem CID 135211199) has the molecular formula C20H14N4O
and a molecular weight of 326.36 g/mol. Its IUPAC name is 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile.
Molecular Properties
| Compound Name | 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile |
| PubChem CID | 135211199 |
| Molecular Formula | C20H14N4O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile |
| SMILES | CC1(C)c2cc(C#N)c(N)cc2C(=O)c2c1[nH]c1cc(C#N)ccc21 |
| InChI | InChI=1S/C20H14N4O/c1-20(2)14-6-11(9-22)15(23)7-13(14)18(25)17-12-4-3-10(8-21)5-16(12)24-19(17)20/h3-7,24H,23H2,1-2H3 |
| InChIKey | OMLGEKZFBOGHEE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile?
The IUPAC name of 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile (CID 135211199) is 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile.
What is the SMILES notation for 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile?
The canonical SMILES for 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile is CC1(C)c2cc(C#N)c(N)cc2C(=O)c2c1[nH]c1cc(C#N)ccc21.
What is the InChIKey of 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile?
The InChIKey is OMLGEKZFBOGHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O/c1-20(2)14-6-11(9-22)15(23)7-13(14)18(25)17-12-4-3-10(8-21)5-16(12)24-19(17)20/h3-7,24H,23H2,1-2H3.
What are the key properties of 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile?
9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile has a molecular weight of 326.36 g/mol, XLogP of 3.36, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3,8-dicarbonitrile is sourced from PubChem (CID 135211199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).