C32H34N4O2 — CID 135211212
9-(2-cyclopropylethynyl)-11-hydroxy-5,6,6-trimethyl-8-[4-(oxetan-3-yl)piperazin-1-yl]-11H-benzo[b]carbazole-3-carbonitrile (PubChem CID 135211212) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 9-(2-cyclopropylethynyl)-11-hydroxy-5,6,6-trimethyl-8-[4-(oxetan-3-yl)piperazin-1-yl]-11H-benzo[b]carbazole-3-carbonitrile.
| Compound Name | 9-(2-cyclopropylethynyl)-11-hydroxy-5,6,6-trimethyl-8-[4-(oxetan-3-yl)piperazin-1-yl]-11H-benzo[b]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 135211212 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 9-(2-cyclopropylethynyl)-11-hydroxy-5,6,6-trimethyl-8-[4-(oxetan-3-yl)piperazin-1-yl]-11H-benzo[b]carbazole-3-carbonitrile |
| SMILES | Cn1c2c(c3ccc(C#N)cc31)C(O)c1cc(C#CC3CC3)c(N3CCN(C4COC4)CC3)cc1C2(C)C |
| InChI | InChI=1S/C32H34N4O2/c1-32(2)26-16-27(36-12-10-35(11-13-36)23-18-38-19-23)22(8-6-20-4-5-20)15-25(26)30(37)29-24-9-7-21(17-33)14-28(24)34(3)31(29)32/h7,9,14-16,20,23,30,37H,4-5,10-13,18-19H2,1-3H3 |
| InChIKey | IAZZNCBJGHNYJO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|