About (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine
(Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine (PubChem CID 135211995) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine |
| PubChem CID | 135211995 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine |
| SMILES | C=N/C=C\CCC(CCNC)CC(C)(C)C |
| InChI | InChI=1S/C14H28N2/c1-14(2,3)12-13(9-11-16-5)8-6-7-10-15-4/h7,10,13,16H,4,6,8-9,11-12H2,1-3,5H3/b10-7- |
| InChIKey | ULDZVRGVMWCURC-YFHOEESVSA-N |
| XLogP | 3.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine?
The IUPAC name of (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine (CID 135211995) is (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine.
What is the SMILES notation for (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine?
The canonical SMILES for (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine is C=N/C=C\CCC(CCNC)CC(C)(C)C.
What is the InChIKey of (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine?
The InChIKey is ULDZVRGVMWCURC-YFHOEESVSA-N. The full InChI is InChI=1S/C14H28N2/c1-14(2,3)12-13(9-11-16-5)8-6-7-10-15-4/h7,10,13,16H,4,6,8-9,11-12H2,1-3,5H3/b10-7-.
What are the key properties of (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine?
(Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine has a molecular weight of 224.39 g/mol, XLogP of 3.64, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(2,2-dimethylpropyl)-N-methyl-7-(methylideneamino)hept-6-en-1-amine is sourced from PubChem (CID 135211995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).