C22H32N6O3 — CID 135212238
8-[[(2Z,4E)-2,5-diamino-5-[ethenyl-(methylideneamino)amino]penta-2,4-dienyl]amino]-2-(4-methyl-5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one (PubChem CID 135212238) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is 8-[[(2Z,4E)-2,5-diamino-5-[ethenyl-(methylideneamino)amino]penta-2,4-dienyl]amino]-2-(4-methyl-5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one.
| Compound Name | 8-[[(2Z,4E)-2,5-diamino-5-[ethenyl-(methylideneamino)amino]penta-2,4-dienyl]amino]-2-(4-methyl-5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 135212238 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 8-[[(2Z,4E)-2,5-diamino-5-[ethenyl-(methylideneamino)amino]penta-2,4-dienyl]amino]-2-(4-methyl-5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one |
| SMILES | C=CN(N=C)/C(N)=C/C=C(\N)CNC1CCC2(CC1)CCN(C1=C(C)C(=O)OC1)C2=O |
| InChI | InChI=1S/C22H32N6O3/c1-4-28(25-3)19(24)6-5-16(23)13-26-17-7-9-22(10-8-17)11-12-27(21(22)30)18-14-31-20(29)15(18)2/h4-6,17,26H,1,3,7-14,23-24H2,2H3/b16-5-,19-6+ |
| InChIKey | IJZGMCFLLSQENJ-VWVMMPOQSA-N |
| XLogP | 1.27 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|