C9H16FN — CID 135212630
2-fluoro-3-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine (PubChem CID 135212630) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is 2-fluoro-3-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine.
| Compound Name | 2-fluoro-3-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 135212630 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 2-fluoro-3-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine |
| SMILES | CC(C)C1=CNC(F)C(C)C1 |
| InChI | InChI=1S/C9H16FN/c1-6(2)8-4-7(3)9(10)11-5-8/h5-7,9,11H,4H2,1-3H3 |
| InChIKey | CYVYLAXWNXDVDG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|