About [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine
[(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine (PubChem CID 135213223) has the molecular formula C16H30N2
and a molecular weight of 250.43 g/mol. Its IUPAC name is [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine.
Molecular Properties
| Compound Name | [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine |
| PubChem CID | 135213223 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine |
| SMILES | C/C=C(\C=C(CNN)/C(=C\CC)CCCC)CC |
| InChI | InChI=1S/C16H30N2/c1-5-9-11-15(10-6-2)16(13-18-17)12-14(7-3)8-4/h7,10,12,18H,5-6,8-9,11,13,17H2,1-4H3/b14-7-,15-10-,16-12- |
| InChIKey | LQIMLBHPEISRIJ-VERXCMGZSA-N |
| XLogP | 4.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine?
The IUPAC name of [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine (CID 135213223) is [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine.
What is the SMILES notation for [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine?
The canonical SMILES for [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine is C/C=C(\C=C(CNN)/C(=C\CC)CCCC)CC.
What is the InChIKey of [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine?
The InChIKey is LQIMLBHPEISRIJ-VERXCMGZSA-N. The full InChI is InChI=1S/C16H30N2/c1-5-9-11-15(10-6-2)16(13-18-17)12-14(7-3)8-4/h7,10,12,18H,5-6,8-9,11,13,17H2,1-4H3/b14-7-,15-10-,16-12-.
What are the key properties of [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine?
[(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine has a molecular weight of 250.43 g/mol, XLogP of 4.26, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,3Z)-2-[(Z)-2-ethylbut-2-enylidene]-3-propylideneheptyl]hydrazine is sourced from PubChem (CID 135213223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).