C26H41N3O2 — CID 135213249
N-(6-acetyl-4-piperidin-1-yl-5-propyl-3-pyridinyl)cyclodecanecarboxamide (PubChem CID 135213249) has the molecular formula C26H41N3O2 and a molecular weight of 427.63 g/mol. Its IUPAC name is N-(6-acetyl-4-piperidin-1-yl-5-propyl-3-pyridinyl)cyclodecanecarboxamide.
| Compound Name | N-(6-acetyl-4-piperidin-1-yl-5-propyl-3-pyridinyl)cyclodecanecarboxamide |
|---|---|
| PubChem CID | 135213249 |
| Molecular Formula | C26H41N3O2 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.32 |
| IUPAC Name | N-(6-acetyl-4-piperidin-1-yl-5-propyl-3-pyridinyl)cyclodecanecarboxamide |
| SMILES | CCCc1c(C(C)=O)ncc(NC(=O)C2CCCCCCCCC2)c1N1CCCCC1 |
| InChI | InChI=1S/C26H41N3O2/c1-3-14-22-24(20(2)30)27-19-23(25(22)29-17-12-9-13-18-29)28-26(31)21-15-10-7-5-4-6-8-11-16-21/h19,21H,3-18H2,1-2H3,(H,28,31) |
| InChIKey | KKCXHWWWGWFEKI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |