C17H24O2 — CID 135213405
(6E,8E)-2-(cyclohexa-1,5-dien-1-ylmethoxy)deca-6,8-dien-5-one (PubChem CID 135213405) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (6E,8E)-2-(cyclohexa-1,5-dien-1-ylmethoxy)deca-6,8-dien-5-one.
| Compound Name | (6E,8E)-2-(cyclohexa-1,5-dien-1-ylmethoxy)deca-6,8-dien-5-one |
|---|---|
| PubChem CID | 135213405 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (6E,8E)-2-(cyclohexa-1,5-dien-1-ylmethoxy)deca-6,8-dien-5-one |
| SMILES | C/C=C/C=C/C(=O)CCC(C)OCC1=CCCC=C1 |
| InChI | InChI=1S/C17H24O2/c1-3-4-6-11-17(18)13-12-15(2)19-14-16-9-7-5-8-10-16/h3-4,6-7,9-11,15H,5,8,12-14H2,1-2H3/b4-3+,11-6+ |
| InChIKey | JKXNWLMCJFCZAH-HFBSYCRKSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|