C22H27N5O4 — CID 135213526
(1R,7S)-N,N,5-trimethyl-9-oxo-3-(phenylmethoxymethyl)-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide (PubChem CID 135213526) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is (1R,7S)-N,N,5-trimethyl-9-oxo-3-(phenylmethoxymethyl)-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide.
| Compound Name | (1R,7S)-N,N,5-trimethyl-9-oxo-3-(phenylmethoxymethyl)-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide |
|---|---|
| PubChem CID | 135213526 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (1R,7S)-N,N,5-trimethyl-9-oxo-3-(phenylmethoxymethyl)-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide |
| SMILES | C=CCON1C(=O)N2C[C@H]1c1c(COCc3ccccc3)nn(C)c1[C@H]2C(=O)N(C)C |
| InChI | InChI=1S/C22H27N5O4/c1-5-11-31-27-17-12-26(22(27)29)20(21(28)24(2)3)19-18(17)16(23-25(19)4)14-30-13-15-9-7-6-8-10-15/h5-10,17,20H,1,11-14H2,2-4H3/t17-,20-/m0/s1 |
| InChIKey | XFCFEIBPTHNQML-PXNSSMCTSA-N |
| XLogP | 2.18 |
| TPSA | 80.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|