C21H24N4O5 — CID 135213531
methyl (1R,7S)-5-methyl-9-oxo-3-(phenylmethoxymethyl)-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylate (PubChem CID 135213531) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is methyl (1R,7S)-5-methyl-9-oxo-3-(phenylmethoxymethyl)-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylate.
| Compound Name | methyl (1R,7S)-5-methyl-9-oxo-3-(phenylmethoxymethyl)-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylate |
|---|---|
| PubChem CID | 135213531 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | methyl (1R,7S)-5-methyl-9-oxo-3-(phenylmethoxymethyl)-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylate |
| SMILES | C=CCON1C(=O)N2C[C@H]1c1c(COCc3ccccc3)nn(C)c1[C@H]2C(=O)OC |
| InChI | InChI=1S/C21H24N4O5/c1-4-10-30-25-16-11-24(21(25)27)19(20(26)28-3)18-17(16)15(22-23(18)2)13-29-12-14-8-6-5-7-9-14/h4-9,16,19H,1,10-13H2,2-3H3/t16-,19-/m0/s1 |
| InChIKey | XCULQLOQHADUFB-LPHOPBHVSA-N |
| XLogP | 2.26 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|