C19H24N8O4 — CID 135213537
(1R,7S)-7-N,7-N,5-trimethyl-3-N-(1-methylpyrazol-4-yl)-9-oxo-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide (PubChem CID 135213537) has the molecular formula C19H24N8O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is (1R,7S)-7-N,7-N,5-trimethyl-3-N-(1-methylpyrazol-4-yl)-9-oxo-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide.
| Compound Name | (1R,7S)-7-N,7-N,5-trimethyl-3-N-(1-methylpyrazol-4-yl)-9-oxo-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide |
|---|---|
| PubChem CID | 135213537 |
| Molecular Formula | C19H24N8O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (1R,7S)-7-N,7-N,5-trimethyl-3-N-(1-methylpyrazol-4-yl)-9-oxo-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide |
| SMILES | C=CCON1C(=O)N2C[C@H]1c1c(C(=O)Nc3cnn(C)c3)nn(C)c1[C@H]2C(=O)N(C)C |
| InChI | InChI=1S/C19H24N8O4/c1-6-7-31-27-12-10-26(19(27)30)16(18(29)23(2)3)15-13(12)14(22-25(15)5)17(28)21-11-8-20-24(4)9-11/h6,8-9,12,16H,1,7,10H2,2-5H3,(H,21,28)/t12-,16-/m0/s1 |
| InChIKey | HZENORFITUJTMZ-LRDDRELGSA-N |
| XLogP | 0.45 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|