C18H22N6O7S — CID 135213614
[7-(dimethylcarbamoyl)-5-methyl-3-[(1-methylpyridin-1-ium-2-yl)oxymethyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate (PubChem CID 135213614) has the molecular formula C18H22N6O7S and a molecular weight of 466.48 g/mol. Its IUPAC name is [7-(dimethylcarbamoyl)-5-methyl-3-[(1-methylpyridin-1-ium-2-yl)oxymethyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate.
| Compound Name | [7-(dimethylcarbamoyl)-5-methyl-3-[(1-methylpyridin-1-ium-2-yl)oxymethyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate |
|---|---|
| PubChem CID | 135213614 |
| Molecular Formula | C18H22N6O7S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [7-(dimethylcarbamoyl)-5-methyl-3-[(1-methylpyridin-1-ium-2-yl)oxymethyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(COc3cccc[n+]3C)nn2C)C2CN1C(=O)N2OS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H22N6O7S/c1-20(2)17(25)16-15-14(12-9-23(16)18(26)24(12)31-32(27,28)29)11(19-22(15)4)10-30-13-7-5-6-8-21(13)3/h5-8,12,16H,9-10H2,1-4H3 |
| InChIKey | HXLOUPIEJPTOKT-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 141.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|