C18H25N8O7S+ — CID 135213617
[7-(dimethylcarbamoyl)-3-[(1,2-dimethylpyrazol-2-ium-4-yl)methylcarbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 135213617) has the molecular formula C18H25N8O7S+ and a molecular weight of 497.51 g/mol. Its IUPAC name is [7-(dimethylcarbamoyl)-3-[(1,2-dimethylpyrazol-2-ium-4-yl)methylcarbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [7-(dimethylcarbamoyl)-3-[(1,2-dimethylpyrazol-2-ium-4-yl)methylcarbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135213617 |
| Molecular Formula | C18H25N8O7S+ |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | [7-(dimethylcarbamoyl)-3-[(1,2-dimethylpyrazol-2-ium-4-yl)methylcarbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(C(=O)NCc3cn(C)[n+](C)c3)nn2C)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C18H24N8O7S/c1-21(2)17(28)15-14-12(11-9-25(15)18(29)26(11)33-34(30,31)32)13(20-24(14)5)16(27)19-6-10-7-22(3)23(4)8-10/h7-8,11,15H,6,9H2,1-5H3,(H-,19,27,30,31,32)/p+1 |
| InChIKey | DPFKIXQQFVXFGA-UHFFFAOYSA-O |
| XLogP | -1.83 |
| TPSA | 163.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|