C19H22N6O8S — CID 135213663
[3-[(4-carbamoylphenoxy)methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 135213663) has the molecular formula C19H22N6O8S and a molecular weight of 494.49 g/mol. Its IUPAC name is [3-[(4-carbamoylphenoxy)methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [3-[(4-carbamoylphenoxy)methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135213663 |
| Molecular Formula | C19H22N6O8S |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | [3-[(4-carbamoylphenoxy)methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(COc3ccc(C(N)=O)cc3)nn2C)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C19H22N6O8S/c1-22(2)18(27)16-15-14(13-8-24(16)19(28)25(13)33-34(29,30)31)12(21-23(15)3)9-32-11-6-4-10(5-7-11)17(20)26/h4-7,13,16H,8-9H2,1-3H3,(H2,20,26)(H,29,30,31) |
| InChIKey | SZUBYWXDVBRBGE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 177.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|