C17H24N10O7S — CID 135213716
[3-[[4-(2-aminoethylcarbamoyl)triazol-1-yl]methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 135213716) has the molecular formula C17H24N10O7S and a molecular weight of 512.51 g/mol. Its IUPAC name is [3-[[4-(2-aminoethylcarbamoyl)triazol-1-yl]methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [3-[[4-(2-aminoethylcarbamoyl)triazol-1-yl]methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135213716 |
| Molecular Formula | C17H24N10O7S |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | [3-[[4-(2-aminoethylcarbamoyl)triazol-1-yl]methyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(Cn3cc(C(=O)NCCN)nn3)nn2C)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C17H24N10O7S/c1-23(2)16(29)14-13-12(11-8-26(14)17(30)27(11)34-35(31,32)33)9(21-24(13)3)6-25-7-10(20-22-25)15(28)19-5-4-18/h7,11,14H,4-6,8,18H2,1-3H3,(H,19,28)(H,31,32,33) |
| InChIKey | XAKZHLPOWMVHNJ-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 211.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|