C17H23N9O7S — CID 135213722
[3-[(5-amino-1,2-dimethylpyrazol-2-ium-4-yl)carbamoyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate (PubChem CID 135213722) has the molecular formula C17H23N9O7S and a molecular weight of 497.49 g/mol. Its IUPAC name is [3-[(5-amino-1,2-dimethylpyrazol-2-ium-4-yl)carbamoyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate.
| Compound Name | [3-[(5-amino-1,2-dimethylpyrazol-2-ium-4-yl)carbamoyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate |
|---|---|
| PubChem CID | 135213722 |
| Molecular Formula | C17H23N9O7S |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [3-[(5-amino-1,2-dimethylpyrazol-2-ium-4-yl)carbamoyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(C(=O)Nc3c[n+](C)n(C)c3N)nn2C)C2CN1C(=O)N2OS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H23N9O7S/c1-21(2)16(28)13-12-10(9-7-25(13)17(29)26(9)33-34(30,31)32)11(20-23(12)4)15(27)19-8-6-22(3)24(5)14(8)18/h6,9,13,18H,7H2,1-5H3,(H2,19,27,30,31,32) |
| InChIKey | FXSXDHRTTIBFOH-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 192.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|